CAS 1160253-45-1

2-(2,4-Dimethylphenyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(2,4-Dimethylphenyl)-6-methyl-4-quinolinecarbonyl chloride is an organic compound characterized by its complex structure, which includes a quinoline ring system and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and carbonyl compounds, such as potential reactivity in nucleophilic substitution reactions due to the presence of the carbonyl chloride. The presence of multiple methyl groups on the aromatic ring contributes to its hydrophobic character and may influence its solubility in organic solvents. Additionally, the quinoline moiety can impart biological activity, making this compound of interest in medicinal chemistry. Its synthesis and handling require careful consideration due to the reactivity of the carbonyl chloride group, which can hydrolyze in the presence of moisture, leading to the formation of corresponding acids. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals or as intermediates in organic synthesis.

Formula: C₁₉H₁₆ClNO

InChI: InChI=1S/C19H16ClNO/c1-11-4-6-14(13(3)8-11)18-10-16(19(20)22)15-9-12(2)5-7-17(15)21-18/h4-10H,1-3H3

InChI key: InChIKey=KKYWOAQVUBSKHC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=C(C)C=C3)C=CC(C)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(2,4-dimethylphenyl)-6-methyl-
• 2-(2,4-Dimethylphenyl)-6-methyl-4-quinolinecarbonyl chloride