CAS 1160253-51-9

2-(4-Ethylphenyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(4-Ethylphenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with an ethylphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The presence of the ethylphenyl group may enhance its lipophilicity, influencing its solubility in organic solvents. Additionally, the quinoline structure is known for its biological activity, which may suggest potential applications in pharmaceuticals or agrochemicals. The compound's reactivity and stability can be affected by environmental conditions, such as temperature and pH. Overall, 2-(4-Ethylphenyl)-6-methyl-4-quinolinecarbonyl chloride represents a versatile compound with potential utility in various chemical applications, particularly in synthetic organic chemistry.

Formula: C₁₉H₁₆ClNO

InChI: InChI=1S/C19H16ClNO/c1-3-13-5-7-14(8-6-13)18-11-16(19(20)22)15-10-12(2)4-9-17(15)21-18/h4-11H,3H2,1-2H3

InChI key: InChIKey=BQBVJZAEMNCHTI-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC)C=C3)C=CC(C)=C2

Synonyms:

• 2-(4-Ethylphenyl)-6-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(4-ethylphenyl)-6-methyl-