CymitQuimica logo

CAS 1160253-53-1

:

6-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride

Description:
6-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a carbonyl chloride functional group, indicating the presence of a reactive acyl chloride moiety, which can participate in various chemical reactions, such as acylation. The presence of a methyl group and a propylphenyl substituent contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Additionally, the chlorine atom in the carbonyl chloride group can enhance its reactivity, allowing for further derivatization. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose hazards such as irritation or toxicity. Overall, 6-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a versatile compound with potential applications in various fields of chemistry.
Formula:C20H18ClNO
InChI:InChI=1S/C20H18ClNO/c1-3-4-14-6-8-15(9-7-14)19-12-17(20(21)23)16-11-13(2)5-10-18(16)22-19/h5-12H,3-4H2,1-2H3
InChI key:InChIKey=RNQOZQOCGZXKBC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCC)C=C3)C=CC(C)=C2
Synonyms:
  • 6-Methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 6-methyl-2-(4-propylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.