CAS 1160253-57-5
:2-(4-Butylphenyl)-6-methyl-4-quinolinecarbonyl chloride
Description:
2-(4-Butylphenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a butylphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride moiety. The butylphenyl substituent can influence its solubility and interaction with other molecules, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The presence of the carbonyl chloride group suggests that it may participate in nucleophilic substitution reactions, which can be exploited in synthetic pathways. Additionally, the compound's molecular structure may impart specific optical or electronic properties, making it of interest in materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C21H20ClNO
InChI:InChI=1S/C21H20ClNO/c1-3-4-5-15-7-9-16(10-8-15)20-13-18(21(22)24)17-12-14(2)6-11-19(17)23-20/h6-13H,3-5H2,1-2H3
InChI key:InChIKey=IODCKJVBUQAPED-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCCC)C=C3)C=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(4-butylphenyl)-6-methyl-
- 2-(4-Butylphenyl)-6-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.