CAS 1160253-59-7: 6-Methyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride

Description: 6-Methyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system and a carbonyl chloride functional group. The presence of the methyl and isopropyl substituents contributes to its hydrophobic nature, influencing its solubility and reactivity. This compound is likely to exhibit properties typical of carbonyl chlorides, such as being a reactive electrophile, which can participate in nucleophilic substitution reactions. Its quinoline moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, due to the presence of the carbonyl chloride group, it may require careful handling due to its reactivity and potential hazards associated with chlorinated compounds. Overall, this compound exemplifies the complexity and versatility of synthetic organic chemistry, with implications for various fields including drug development and materials science.

Formula: C₂₁H₂₀ClNO

InChI: InChI=1S/C21H20ClNO/c1-13(2)10-15-5-7-16(8-6-15)20-12-18(21(22)24)17-11-14(3)4-9-19(17)23-20/h4-9,11-13H,10H2,1-3H3

InChI key: InChIKey=WYBBKQFATNEKEQ-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC(=CC21)C)C=3C=CC(=CC3)CC(C)C

2-(4-Isobutylphenyl)-6-methylquinoline-4-carbonyl chloride

CAS: 1160253-59-7

Please enquire for more information about 2-(4-Isobutylphenyl)-6-methylquinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₂₁H₂₀ClNO
• Purity: Min. 95%
• Molecular weight: 337.84 g/mol