CymitQuimica logo

CAS 1160253-63-3

:

6-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride

Description:
6-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a methyl group at the 6-position and a 4-(1-methylpropyl)phenyl substituent, contributing to its unique chemical properties. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The quinoline structure suggests that it may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties. Additionally, the compound's hydrophobic characteristics, due to the aromatic rings and alkyl substituents, may influence its solubility and interaction with biological membranes. Overall, this compound's specific reactivity and potential applications in medicinal chemistry or material science warrant further investigation. However, safety precautions should be taken when handling it, as carbonyl chlorides can be hazardous.
Formula:C21H20ClNO
InChI:InChI=1S/C21H20ClNO/c1-4-14(3)15-6-8-16(9-7-15)20-12-18(21(22)24)17-11-13(2)5-10-19(17)23-20/h5-12,14H,4H2,1-3H3
InChI key:InChIKey=XLRYMLCTIJSTJI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(CC)C)C=C3)C=CC(C)=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 6-methyl-2-[4-(1-methylpropyl)phenyl]-
  • 6-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.