CAS 1160253-65-5

2-(2-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(2-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chlorophenyl group and a carbonyl chloride functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom enhances its electrophilic properties, making it useful in various chemical reactions, including acylation and substitution reactions. The methyl group at the 6-position of the quinoline ring can influence the compound's solubility and stability. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its reactivity as an acyl chloride suggests potential uses in the synthesis of more complex organic molecules. As with many chlorinated compounds, appropriate safety measures should be taken when handling this substance due to its potential toxicity and environmental impact.

Formula: C₁₇H₁₁Cl₂NO

InChI: InChI=1S/C17H11Cl2NO/c1-10-6-7-15-12(8-10)13(17(19)21)9-16(20-15)11-4-2-3-5-14(11)18/h2-9H,1H3

InChI key: InChIKey=GAQKMXVWLOCTNZ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(Cl)C=CC=C3)C=CC(C)=C2

Synonyms:

• 2-(2-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(2-chlorophenyl)-6-methyl-