CAS 1160253-67-7

2-(4-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(4-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chlorophenyl group and a carbonyl chloride functional group, indicating it is likely reactive due to the presence of the acyl chloride moiety. The chlorophenyl substituent contributes to its potential biological activity, while the methyl group at the 6-position of the quinoline ring may influence its solubility and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity as an acyl chloride suggests it can participate in nucleophilic acyl substitution reactions, making it valuable in the synthesis of various derivatives. Safety precautions should be observed when handling this compound due to its potential irritant properties and reactivity. As with many quinoline derivatives, it may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry.

Formula: C₁₇H₁₁Cl₂NO

InChI: InChI=1S/C17H11Cl2NO/c1-10-2-7-15-13(8-10)14(17(19)21)9-16(20-15)11-3-5-12(18)6-4-11/h2-9H,1H3

InChI key: InChIKey=RIDOESJNHZVAIQ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)C=C3)C=CC(C)=C2

Synonyms:

• 2-(4-Chlorophenyl)-6-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(4-chlorophenyl)-6-methyl-