CAS 1160253-73-5
:2-(2-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
Description:
2-(2-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160253-73-5, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carbonyl chloride functional group, indicating it is a derivative of an acyl chloride, which typically makes it reactive and useful in various synthetic applications. The presence of the methoxyphenyl group suggests that it may exhibit interesting electronic properties and potential for interactions in biological systems. The methyl group at the 6-position of the quinoline ring can influence the compound's steric and electronic characteristics, potentially affecting its reactivity and solubility. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling precautions are essential due to the reactive nature of the carbonyl chloride group, which can release hydrochloric acid upon hydrolysis.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-11-7-8-15-13(9-11)14(18(19)21)10-16(20-15)12-5-3-4-6-17(12)22-2/h3-10H,1-2H3
InChI key:InChIKey=BPTZSBIOOAANKI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=C(C)C=C3)C=CC=C1
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(2-methoxyphenyl)-6-methyl-
- 2-(2-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.