CAS 1160253-75-7
:2-(3-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
Description:
2-(3-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160253-75-7, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carbonyl chloride functional group, indicating it is a derivative of an acid chloride, which typically makes it reactive and useful in various synthetic applications. The presence of the methoxyphenyl group suggests that it may exhibit interesting electronic properties and potential biological activity, as methoxy groups can influence the solubility and reactivity of organic compounds. Additionally, the methyl group on the quinoline ring may affect the compound's sterics and overall stability. Such compounds are often explored in medicinal chemistry for their potential therapeutic effects, as well as in materials science for their unique properties. However, specific safety and handling guidelines should be followed due to the reactive nature of the carbonyl chloride moiety.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-11-6-7-16-14(8-11)15(18(19)21)10-17(20-16)12-4-3-5-13(9-12)22-2/h3-10H,1-2H3
InChI key:InChIKey=YJRJMNGPMGIIHM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=CC=C3)C=CC(C)=C2
Synonyms:- 2-(3-Methoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(3-methoxyphenyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.