CAS 1160253-85-9

2-(2-Ethoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(2-Ethoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with an ethoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The ethoxy group may enhance solubility in organic solvents, while the quinoline structure can contribute to biological activity, making it of interest in medicinal chemistry. The compound's molecular weight, boiling point, and melting point would depend on its specific structural features and intermolecular interactions. Additionally, safety considerations are important, as carbonyl chlorides can be reactive and potentially hazardous. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and pharmaceutical development.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c1-3-23-18-7-5-4-6-13(18)17-11-15(19(20)22)14-10-12(2)8-9-16(14)21-17/h4-11H,3H2,1-2H3

InChI key: InChIKey=XGQCIMZUPGYQAA-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=C(C)C=C3)C=CC=C1

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(2-ethoxyphenyl)-6-methyl-
• 2-(2-Ethoxyphenyl)-6-methyl-4-quinolinecarbonyl chloride