CAS 1160253-91-7
:6-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
Description:
6-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carbonyl chloride functional group, indicating the presence of a reactive acyl chloride, which can participate in various chemical reactions, such as acylation. The presence of a methyl group and a propoxyphenyl substituent contributes to its unique properties, potentially influencing its solubility, reactivity, and biological activity. Compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development or as intermediates in organic synthesis. However, due to the presence of the carbonyl chloride group, it is important to handle this compound with care, as it can be reactive and may pose safety hazards. Overall, the characteristics of this compound make it a subject of interest in various fields, including organic synthesis and pharmaceutical research.
Formula:C20H18ClNO2
InChI:InChI=1S/C20H18ClNO2/c1-3-9-24-15-6-4-5-14(11-15)19-12-17(20(21)23)16-10-13(2)7-8-18(16)22-19/h4-8,10-12H,3,9H2,1-2H3
InChI key:InChIKey=AIECWIRJBJYSOW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-methyl-2-(3-propoxyphenyl)-
- 6-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
- 6-methyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.