CAS 1160253-97-3

6-Methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

6-Methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system, a carbonyl chloride functional group, and an alkoxy substituent. This compound typically exhibits properties associated with halogenated carbonyl compounds, such as reactivity towards nucleophiles due to the presence of the carbonyl chloride group. The quinoline moiety contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties. The presence of the methyl and propoxy groups can influence its solubility, stability, and interaction with biological targets. In terms of physical properties, compounds of this nature may be solid at room temperature and have moderate to high melting points, depending on their specific molecular interactions. Additionally, the compound's reactivity profile suggests it may be useful in various synthetic applications, particularly in medicinal chemistry and the development of new therapeutic agents. Safety and handling precautions are essential due to the presence of the reactive carbonyl chloride group.

Formula: C₂₁H₂₀ClNO₂

InChI: InChI=1S/C21H20ClNO2/c1-13(2)12-25-16-6-4-5-15(10-16)20-11-18(21(22)24)17-9-14(3)7-8-19(17)23-20/h4-11,13H,12H2,1-3H3

InChI key: InChIKey=PODDZNJAKPYAFE-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC(C)C)=CC=C3)C=CC(C)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-methyl-2-[3-(2-methylpropoxy)phenyl]-
• 6-Methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-quinolinecarbonyl chloride, 6-methyl-2-[3-(2-methylpropo
• 2-(3-isobutoxyphenyl)-6-methylquinoline-4-carbonyl chloride