CAS 1160253-99-5: 2-(1,3-Benzodioxol-5-yl)-6-methyl-4-quinolinecarbonyl chloride

Description: 2-(1,3-Benzodioxol-5-yl)-6-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160253-99-5, is a synthetic organic compound characterized by its complex structure that includes a quinoline moiety and a benzodioxole group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride functional group. The benzodioxole fragment contributes to its potential biological activity, as compounds containing this moiety are often explored for pharmacological properties. The presence of the carbonyl chloride group suggests that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the methyl group at the 6-position of the quinoline ring may influence its solubility and reactivity. Overall, this compound is of interest in medicinal chemistry and may serve as a precursor for the development of novel therapeutic agents.

Formula: C₁₈H₁₂ClNO₃

InChI: InChI=1S/C18H12ClNO3/c1-10-2-4-14-12(6-10)13(18(19)21)8-15(20-14)11-3-5-16-17(7-11)23-9-22-16/h2-8H,9H2,1H3

InChI key: InChIKey=IXMUHHLQSJKZJQ-UHFFFAOYSA-N

SMILES: O=C(Cl)C1=CC(=NC=2C=CC(=CC21)C)C=3C=CC=4OCOC4C3

2-(1,3-benzodioxol-5-yl)-6-methylquinoline-4-carbonyl chloride

CAS: 1160253-99-5

• Molecular weight: 325.75

2-(1,3-Benzodioxol-5-yl)-6-methylquinoline-4-carbonyl chloride

CAS: 1160253-99-5

Please enquire for more information about 2-(1,3-Benzodioxol-5-yl)-6-methylquinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₈H₁₂ClNO₃
• Purity: Min. 95%
• Molecular weight: 325.75 g/mol