CAS 1160254-09-0

8-Methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride

Description:

8-Methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a carbonyl chloride functional group, indicating the presence of a reactive acyl chloride moiety, which can participate in various chemical reactions, such as acylation. The presence of methyl groups on both the quinoline and phenyl rings contributes to its hydrophobic nature and may influence its solubility and reactivity. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the quinoline's biological activity. Additionally, the presence of the carbonyl chloride group makes it a useful intermediate for further chemical transformations. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols. Overall, 8-Methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₈H₁₄ClNO

InChI: InChI=1S/C18H14ClNO/c1-11-6-3-4-8-13(11)16-10-15(18(19)21)14-9-5-7-12(2)17(14)20-16/h3-10H,1-2H3

InChI key: InChIKey=BBBDZDNXKOSYAG-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=CC=C3)C(C)=CC=C2

Synonyms:

• 8-Methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-methyl-2-(2-methylphenyl)-