CAS 1160254-19-2

2-(2,5-Dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

2-(2,5-Dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and carbonyl compounds, such as potential reactivity due to the presence of the acyl chloride group, which can participate in nucleophilic acyl substitution reactions. The presence of multiple methyl groups on the phenyl ring contributes to its hydrophobic character and may influence its solubility in organic solvents. Additionally, the quinoline structure can impart certain biological activities, making it of interest in medicinal chemistry. The compound's reactivity and stability can be affected by environmental factors such as temperature and moisture, as acyl chlorides are generally sensitive to hydrolysis. Overall, this compound's unique structural features suggest potential applications in organic synthesis and pharmaceutical development, although specific applications would depend on further research and characterization.

Formula: C₁₉H₁₆ClNO

InChI: InChI=1S/C19H16ClNO/c1-11-7-8-12(2)15(9-11)17-10-16(19(20)22)14-6-4-5-13(3)18(14)21-17/h4-10H,1-3H3

InChI key: InChIKey=FWXHISRGCRFOHD-UHFFFAOYSA-N

SMILES: CC1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3C)C=C(C)C=C1

Synonyms:

• 2-(2,5-Dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(2,5-dimethylphenyl)-8-methyl-