CymitQuimica logo

CAS 1160254-21-6

:

2-(4-Ethylphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
2-(4-Ethylphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, an ethylphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinoline ring, which is known for its pharmacological significance. The carbonyl chloride functional group suggests reactivity, particularly in nucleophilic substitution reactions, making it useful in synthetic organic chemistry. The presence of the ethyl group can influence the compound's solubility and stability, while the methyl group may affect its steric properties. Overall, this compound may serve as an intermediate in the synthesis of more complex molecules or as a potential candidate for further biological evaluation, depending on its reactivity and functionalization potential. As with many chemical substances, handling should be done with care, considering safety protocols due to the reactive nature of the carbonyl chloride group.
Formula:C19H16ClNO
InChI:InChI=1S/C19H16ClNO/c1-3-13-7-9-14(10-8-13)17-11-16(19(20)22)15-6-4-5-12(2)18(15)21-17/h4-11H,3H2,1-2H3
InChI key:InChIKey=CHSVOPUMJSBDJT-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC)C=C3)C(C)=CC=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 2-(4-ethylphenyl)-8-methyl-
  • 2-(4-Ethylphenyl)-8-methyl-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.