CymitQuimica logo

CAS 1160254-27-2

:

2-[4-(1,1-Dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride

Description:
2-[4-(1,1-Dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160254-27-2, is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a bulky tert-butyl group attached to a phenyl ring, contributing to its steric properties and potentially influencing its reactivity and solubility. The presence of the carbonyl chloride functional group suggests that it may participate in nucleophilic acyl substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the quinoline structure is known for its biological activity, which may include antimicrobial and antitumor properties. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound's unique structural features make it of interest in both synthetic chemistry and potential pharmaceutical applications.
Formula:C21H20ClNO
InChI:InChI=1S/C21H20ClNO/c1-13-6-5-7-16-17(20(22)24)12-18(23-19(13)16)14-8-10-15(11-9-14)21(2,3)4/h5-12H,1-4H3
InChI key:InChIKey=GQCOXVBNAKNNRW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)(C)C)C=C3)C(C)=CC=C2
Synonyms:
  • 2-[4-(1,1-Dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.