CAS 1160254-29-4
:8-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Description:
8-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a methyl group at the 8-position and a para-substituted phenyl group with a branched alkyl chain at the 2-position of the quinoline ring. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block for more complex molecules. The compound's physical properties, such as solubility and melting point, would depend on its specific interactions with solvents and other chemical entities. Safety and handling precautions are essential due to the reactive nature of the carbonyl chloride group, which can release hydrochloric acid upon hydrolysis. Overall, this compound exemplifies the intricate design often found in organic chemistry, with implications for various chemical applications.
Formula:C21H20ClNO
InChI:InChI=1S/C21H20ClNO/c1-4-13(2)15-8-10-16(11-9-15)19-12-18(21(22)24)17-7-5-6-14(3)20(17)23-19/h5-13H,4H2,1-3H3
InChI key:InChIKey=CUWSJBFEBCCYIT-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(CC)C)C=C3)C(C)=CC=C2
Synonyms:- 8-Methyl-2-[4-(1-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 8-methyl-2-[4-(1-methylpropyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.