CAS 1160254-31-8
:2-(2-Chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(2-Chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160254-31-8, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring, providing it with notable aromatic properties. The presence of a chlorophenyl group and a carbonyl chloride functional group contributes to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. The carbonyl chloride moiety suggests that it can participate in acylation reactions, potentially serving as an acylating agent. Additionally, the methyl group at the 8-position of the quinoline ring may influence the compound's solubility and interaction with biological targets. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C17H11Cl2NO
InChI:InChI=1S/C17H11Cl2NO/c1-10-5-4-7-11-13(17(19)21)9-15(20-16(10)11)12-6-2-3-8-14(12)18/h2-9H,1H3
InChI key:InChIKey=LBGHYLOUZCXBKY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(Cl)C=CC=C3)C(C)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(2-chlorophenyl)-8-methyl-
- 2-(2-Chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.