CAS 1160254-35-2: 2-(3-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride

Description: 2-(3-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a bromophenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the bromine atom, which can participate in various substitution reactions. The carbonyl chloride group is known for its reactivity, particularly in acylation reactions, making this compound useful in synthetic organic chemistry. Additionally, the presence of the methyl group at the 8-position of the quinoline ring can influence its solubility and biological activity. The compound may also exhibit fluorescence properties, common in quinoline derivatives, which can be advantageous in applications such as dye synthesis or as a fluorescent probe. Overall, this compound's structural features suggest potential utility in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.

Formula: C₁₇H₁₁BrClNO

InChI: InChI=1S/C17H11BrClNO/c1-10-4-2-7-13-14(17(19)21)9-15(20-16(10)13)11-5-3-6-12(18)8-11/h2-9H,1H3

InChI key: InChIKey=YGDXZKAQRQDDFY-UHFFFAOYSA-N

SMILES: O=C(Cl)C=1C=C(N=C2C1C=CC=C2C)C=3C=CC=C(Br)C3

Synonyms:

• 2-(3-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-bromophenyl)-8-methyl-

2-(3-bromophenyl)-8-methylquinoline-4-carbonyl chloride

CAS: 1160254-35-2

• Molecular weight: 360.6400146484375

2-(3-Bromophenyl)-8-methylquinoline-4-carbonyl chloride

CAS: 1160254-35-2

Please enquire for more information about 2-(3-Bromophenyl)-8-methylquinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₇H₁₁BrClNO
• Purity: Min. 95%
• Molecular weight: 360.63 g/mol