CAS 1160254-37-4
:2-(4-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(4-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160254-37-4, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a bromophenyl group at the 2-position and a carbonyl chloride functional group enhances its reactivity and potential applications in organic synthesis. The carbonyl chloride moiety indicates that it can participate in acylation reactions, making it useful in the synthesis of various organic compounds. Additionally, the methyl group at the 8-position contributes to its steric and electronic properties, potentially influencing its biological activity. This compound may exhibit interesting pharmacological properties, as many quinoline derivatives are known for their medicinal applications, including antimalarial and anticancer activities. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C17H11BrClNO
InChI:InChI=1S/C17H11BrClNO/c1-10-3-2-4-13-14(17(19)21)9-15(20-16(10)13)11-5-7-12(18)8-6-11/h2-9H,1H3
InChI key:InChIKey=JWONOCPLIRCKCR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Br)C=C3)C(C)=CC=C2
Synonyms:- 2-(4-Bromophenyl)-8-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(4-bromophenyl)-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.