CAS 1160254-39-6
:2-(2-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(2-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, a methoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group may influence its solubility and polarity, while the methyl group on the quinoline ring can affect its steric properties and reactivity. This compound may be of interest in medicinal chemistry and organic synthesis, particularly for the development of pharmaceuticals or agrochemicals. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure, which can dictate interactions with biological targets or other chemical species. Safety and handling precautions should be observed due to the presence of the reactive carbonyl chloride group.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-11-6-5-8-12-14(18(19)21)10-15(20-17(11)12)13-7-3-4-9-16(13)22-2/h3-10H,1-2H3
InChI key:InChIKey=XDOOJHZFPIKVHF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3C)C=CC=C1
Synonyms:- 2-(2-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(2-methoxyphenyl)-8-methyl-
- 2-(2-methoxyphenyl)-8-methylquinoline-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.