CymitQuimica logo

CAS 1160254-43-2

:

2-(4-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
2-(4-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a methoxyphenyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The methoxy group can influence the compound's solubility and reactivity, often enhancing its lipophilicity. Additionally, the presence of the methyl group on the quinoline ring may affect the compound's electronic properties and steric hindrance. This compound may be of interest in medicinal chemistry for its potential biological activities, as quinoline derivatives are known for various pharmacological effects. However, specific applications and biological activities would require further investigation through experimental studies. Safety precautions should be taken when handling this compound due to the reactive nature of the carbonyl chloride functional group.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-11-4-3-5-14-15(18(19)21)10-16(20-17(11)14)12-6-8-13(22-2)9-7-12/h3-10H,1-2H3
InChI key:InChIKey=QYGJZSRWTOMMPH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC)C=C3)C(C)=CC=C2
Synonyms:
  • 2-(4-Methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 2-(4-methoxyphenyl)-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.