CAS 1160254-45-4
:2-(3,4-Dimethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(3,4-Dimethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a carbonyl chloride functional group. The presence of the dimethoxyphenyl group contributes to its potential for various chemical reactivity and biological activity. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its aromatic and polar functional groups. The carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the methyl and methoxy substituents can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. As with many chlorinated compounds, it may pose certain hazards, including toxicity and reactivity, necessitating careful handling and storage. Overall, this compound's structural features suggest it may have applications in medicinal chemistry or as a building block for more complex organic molecules.
Formula:C19H16ClNO3
InChI:InChI=1S/C19H16ClNO3/c1-11-5-4-6-13-14(19(20)22)10-15(21-18(11)13)12-7-8-16(23-2)17(9-12)24-3/h4-10H,1-3H3
InChI key:InChIKey=GLQGRGRQOXPEGP-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=C(OC)C=C3)C(C)=CC=C2
Synonyms:- 2-(3,4-Dimethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 2-(3,4-dimethoxyphenyl)-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.