CymitQuimica logo

CAS 1160254-49-8

:

2-(4-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
2-(4-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, an ethoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The ethoxy group contributes to its solubility in organic solvents, while the methyl group on the quinoline ring may influence its electronic properties and steric hindrance. As a carbonyl chloride, it is likely to be reactive, particularly with nucleophiles, making it useful in synthetic organic chemistry for the preparation of various derivatives. Additionally, compounds of this nature may exhibit biological activity, although specific biological properties would require further investigation. Overall, this compound's characteristics make it a valuable intermediate in chemical synthesis and potentially in pharmaceutical applications.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-3-23-14-9-7-13(8-10-14)17-11-16(19(20)22)15-6-4-5-12(2)18(15)21-17/h4-11H,3H2,1-2H3
InChI key:InChIKey=VVPKEYVAKSEHRS-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC)C=C3)C(C)=CC=C2
Synonyms:
  • 2-(4-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 2-(4-ethoxyphenyl)-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.