CymitQuimica logo

CAS 1160254-51-2

:

2-(3-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
2-(3-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, an ethoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The ethoxy group contributes to its solubility in organic solvents, while the quinoline structure may impart biological activity, making it of interest in medicinal chemistry. The presence of the methyl group at the 8-position of the quinoline ring can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. Overall, this compound may be utilized in various applications, including pharmaceuticals and organic synthesis, although specific applications would depend on further research and characterization.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-3-23-14-8-5-7-13(10-14)17-11-16(19(20)22)15-9-4-6-12(2)18(15)21-17/h4-11H,3H2,1-2H3
InChI key:InChIKey=URXFHTROJWTBMR-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC)=CC=C3)C(C)=CC=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 2-(3-ethoxyphenyl)-8-methyl-
  • 2-(3-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.