CAS 1160254-53-4

2-(2-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

2-(2-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, an ethoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The ethoxy group may enhance solubility in organic solvents and influence the compound's overall polarity. Additionally, the methyl group at the 8-position of the quinoline ring can affect the electronic properties and steric hindrance of the molecule. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as an intermediate in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c1-3-23-17-10-5-4-8-14(17)16-11-15(19(20)22)13-9-6-7-12(2)18(13)21-16/h4-11H,3H2,1-2H3

InChI key: InChIKey=FNHOCZKBWCQEBZ-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3C)C=CC=C1

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(2-ethoxyphenyl)-8-methyl-
• 2-(2-Ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride