CymitQuimica logo

CAS 1160254-57-8

:

8-Methyl-2-[4-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride

Description:
8-Methyl-2-[4-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a methyl group at the 8-position of the quinoline ring and a para-substituted phenyl group that is further substituted with an ethoxy group, contributing to its unique chemical properties. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. Its molecular structure suggests that it may exhibit specific biological activities, although detailed biological data would be necessary to confirm any such properties. Additionally, the compound's solubility, stability, and reactivity would depend on the solvent and conditions used in experiments. As with many synthetic compounds, safety precautions should be taken when handling it, given the potential hazards associated with carbonyl chlorides. Overall, this compound represents a valuable entity in the field of organic chemistry and materials science.
Formula:C20H18ClNO2
InChI:InChI=1S/C20H18ClNO2/c1-12(2)24-15-9-7-14(8-10-15)18-11-17(20(21)23)16-6-4-5-13(3)19(16)22-18/h4-12H,1-3H3
InChI key:InChIKey=VHZKSJYMMYLWOS-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC(C)C)C=C3)C(C)=CC=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 8-methyl-2-[4-(1-methylethoxy)phenyl]-
  • 8-Methyl-2-[4-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
  • 2-(4-isopropoxyphenyl)-8-methylquinoline-4-carbonyl chloride
  • 4-quinolinecarbonyl chloride, 8-methyl-2-[4-(1-methylethox
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.