CAS 1160254-61-4
:8-Methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
8-Methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a methyl group at the 8-position of the quinoline ring and a phenyl group substituted with a 2-methylpropoxy group at the 2-position. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a potentially reactive intermediate in organic synthesis. The compound's molecular structure suggests it may exhibit specific biological activities, possibly related to its quinoline framework, which is known for various pharmacological properties. Additionally, its solubility and stability can be influenced by the substituents on the aromatic rings. As with many synthetic compounds, safety and handling precautions should be observed due to the reactive nature of the carbonyl chloride group. Overall, this compound represents a unique structure that may have applications in medicinal chemistry or material science.
Formula:C21H20ClNO2
InChI:InChI=1S/C21H20ClNO2/c1-13(2)12-25-16-9-7-15(8-10-16)19-11-18(21(22)24)17-6-4-5-14(3)20(17)23-19/h4-11,13H,12H2,1-3H3
InChI key:InChIKey=ZDDHSBRDOFHAEN-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C(C)=CC=C2
Synonyms:- 8-Methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 8-methyl-2-[4-(2-methylpropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.