CAS 1160254-63-6

8-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride

Description:

8-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system, a carbonyl chloride functional group, and a propoxyphenyl substituent. The presence of the methyl group at the 8-position of the quinoline enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The carbonyl chloride group is reactive, making the compound useful in various chemical reactions, particularly in acylation processes. This compound may exhibit interesting pharmacological properties due to its structural features, which could allow for interactions with biological targets. Its synthesis typically involves multi-step organic reactions, and it may be utilized in medicinal chemistry for developing new therapeutic agents. As with many chlorinated compounds, appropriate safety measures should be taken when handling it, given the potential for reactivity and toxicity associated with carbonyl chlorides. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₂₀H₁₈ClNO₂

InChI: InChI=1S/C20H18ClNO2/c1-3-10-24-15-8-5-7-14(11-15)18-12-17(20(21)23)16-9-4-6-13(2)19(16)22-18/h4-9,11-12H,3,10H2,1-2H3

InChI key: InChIKey=UZIKITFGATYHFC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C(C)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-methyl-2-(3-propoxyphenyl)-
• 8-Methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride