CAS 1160254-73-8

8-Methyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

8-Methyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a methyl group at the 8-position of the quinoline ring, contributing to its hydrophobic properties. The presence of the 1-methylethoxy group enhances its lipophilicity and may influence its solubility in organic solvents. As a carbonyl chloride, it is likely to be reactive, particularly with nucleophiles, making it useful in various chemical synthesis applications, including the formation of amides or esters. The compound's unique structure may also impart specific biological activities, which could be of interest in pharmaceutical research. However, due to the presence of the carbonyl chloride functional group, it may pose hazards such as irritancy or corrosiveness, necessitating careful handling and storage. Overall, this compound exemplifies the complexity and versatility of synthetic organic chemistry, with potential applications in medicinal chemistry and materials science.

Formula: C₂₀H₁₈ClNO₂

InChI: InChI=1S/C20H18ClNO2/c1-12(2)24-18-10-5-4-8-15(18)17-11-16(20(21)23)14-9-6-7-13(3)19(14)22-17/h4-12H,1-3H3

InChI key: InChIKey=LWVMXNJZGXPWBV-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3C)C=CC=C1

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-methyl-2-[2-(1-methylethoxy)phenyl]-
• 8-Methyl-2-[2-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-quinolinecarbonyl chloride, 8-methyl-2-[2-(1-methylethox
• 2-(2-isopropoxyphenyl)-8-methylquinoline-4-carbonyl chloride