CAS 1160254-79-4

6,8-Dimethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride

Description:

6,8-Dimethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its unique structure, which includes a quinoline ring system substituted with methyl groups and a thienyl group. This compound features a carbonyl chloride functional group, which makes it reactive and suitable for further chemical modifications. The presence of the quinoline moiety suggests potential biological activity, as quinolines are known for their pharmacological properties, including antimicrobial and antimalarial effects. The thienyl group adds to the compound's complexity and may influence its electronic properties and reactivity. In terms of physical properties, while specific values may vary, compounds of this type typically exhibit moderate solubility in organic solvents and may have distinct melting or boiling points. The reactivity of the carbonyl chloride group allows for nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Overall, this compound's structural features and functional groups position it as a potentially interesting candidate for research in medicinal chemistry and material science.

Formula: C₁₆H₁₂ClNOS

InChI: InChI=1S/C16H12ClNOS/c1-9-6-10(2)15-11(7-9)12(16(17)19)8-13(18-15)14-4-3-5-20-14/h3-8H,1-2H3

InChI key: InChIKey=QRXDGMQQTPIIRX-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CS3)C(C)=CC(C)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-(2-thienyl)-
• 6,8-Dimethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride