CAS 1160254-81-8
:6,8-Dimethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Description:
6,8-Dimethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, methyl groups, and a thienyl substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation. The presence of multiple methyl groups contributes to its hydrophobic nature, while the thienyl ring introduces heteroatoms that can influence its reactivity and solubility. Typically, compounds of this nature are of interest in medicinal chemistry and material science due to their potential biological activity and utility in synthesizing more complex molecules. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Safety precautions should be taken when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols.
Formula:C17H14ClNOS
InChI:InChI=1S/C17H14ClNOS/c1-9-6-10(2)16-12(7-9)13(17(18)20)8-14(19-16)15-5-4-11(3)21-15/h4-8H,1-3H3
InChI key:InChIKey=KZVVIFLXXJJJEM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)S3)C(C)=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-(5-methyl-2-thienyl)-
- 6,8-Dimethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.