CAS 1160254-87-4
:6,8-Dimethyl-2-phenyl-4-quinolinecarbonyl chloride
Description:
6,8-Dimethyl-2-phenyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a carbonyl chloride functional group, indicating it is a derivative of an acyl chloride, which is known for its reactivity, particularly in nucleophilic acyl substitution reactions. The presence of two methyl groups at the 6 and 8 positions and a phenyl group at the 2 position contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and biological activity. The compound may exhibit various applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the versatility of the quinoline framework. Additionally, the carbonyl chloride group can facilitate the introduction of other functional groups, making it a valuable intermediate in chemical synthesis. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C18H14ClNO
InChI:InChI=1S/C18H14ClNO/c1-11-8-12(2)17-14(9-11)15(18(19)21)10-16(20-17)13-6-4-3-5-7-13/h3-10H,1-2H3
InChI key:InChIKey=MVWNXEHEHMJASL-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(C(Cl)=O)=CC(=N2)C3=CC=CC=C3)C=C(C)C1
Synonyms:- 6,8-Dimethyl-2-phenyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.