CAS 1160254-93-2
:2-(2,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Description:
2-(2,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features multiple methyl groups that contribute to its hydrophobic nature and influence its reactivity. The presence of the carbonyl chloride functional group suggests that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The quinoline structure is known for its biological activity, often exhibiting antimicrobial and antitumor properties. Additionally, the compound's molecular configuration may affect its solubility, stability, and interaction with biological systems. As with many chlorinated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, 2-(2,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride represents a unique compound of interest in both synthetic chemistry and pharmacology.
Formula:C20H18ClNO
InChI:InChI=1S/C20H18ClNO/c1-11-5-6-15(13(3)7-11)18-10-17(20(21)23)16-9-12(2)8-14(4)19(16)22-18/h5-10H,1-4H3
InChI key:InChIKey=MLFLVFBLSDLLGQ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=C(C)C=C3)C(C)=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(2,4-dimethylphenyl)-6,8-dimethyl-
- 2-(2,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.