CAS 1160254-95-4
:2-(3,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Description:
2-(3,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features a quinoline ring system, which is known for its aromatic properties and potential biological activity. The presence of multiple methyl groups on both the phenyl and quinoline rings contributes to its hydrophobic characteristics, influencing its solubility and reactivity. The carbonyl chloride functional group indicates that this compound can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the specific arrangement of substituents may impart unique electronic properties, potentially affecting its interaction with biological targets. As with many chlorinated compounds, it is essential to handle this substance with care due to its reactivity and potential toxicity. Overall, this compound's structural features suggest it may have applications in medicinal chemistry or materials science, although further studies would be necessary to explore its full potential.
Formula:C20H18ClNO
InChI:InChI=1S/C20H18ClNO/c1-11-7-14(4)19-16(8-11)17(20(21)23)10-18(22-19)15-6-5-12(2)13(3)9-15/h5-10H,1-4H3
InChI key:InChIKey=YRSWZDDYOVRHHM-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(C(Cl)=O)=CC(=N2)C3=CC(C)=C(C)C=C3)C=C(C)C1
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(3,4-dimethylphenyl)-6,8-dimethyl-
- 2-(3,4-Dimethylphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.