CAS 1160255-01-5
:6,8-Dimethyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride
Description:
6,8-Dimethyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system. This compound features two methyl groups at the 6 and 8 positions of the quinoline, contributing to its hydrophobic properties and potential biological activity. The presence of a carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The 4-propylphenyl substituent enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological targets. Additionally, its unique combination of functional groups suggests potential applications in materials science or as a reagent in chemical synthesis. However, specific safety and handling precautions should be observed due to the reactive nature of the carbonyl chloride moiety.
Formula:C21H20ClNO
InChI:InChI=1S/C21H20ClNO/c1-4-5-15-6-8-16(9-7-15)19-12-18(21(22)24)17-11-13(2)10-14(3)20(17)23-19/h6-12H,4-5H2,1-3H3
InChI key:InChIKey=XKBKFPDUDLKXFT-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCC)C=C3)C(C)=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-(4-propylphenyl)-
- 6,8-Dimethyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.