CAS 1160255-88-8
:2-(4-Butoxyphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(4-Butoxyphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160255-88-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core substituted with various functional groups. This compound features a butoxy group attached to a phenyl ring, a chlorine atom at the 7-position, and a carbonyl chloride functional group, which contributes to its reactivity. The presence of the carbonyl chloride makes it a potential acylating agent, allowing it to participate in various chemical reactions, including nucleophilic acyl substitution. The quinoline moiety is known for its biological activity, often exhibiting antimicrobial and antimalarial properties. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential pharmaceutical development. Overall, this compound's unique structure and functional groups suggest it may have significant utility in medicinal chemistry and related fields.
Formula:C21H19Cl2NO2
InChI:InChI=1S/C21H19Cl2NO2/c1-3-4-11-26-15-7-5-14(6-8-15)19-12-17(21(23)25)16-9-10-18(22)13(2)20(16)24-19/h5-10,12H,3-4,11H2,1-2H3
InChI key:InChIKey=APUUSQMYFCWRLO-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCCCC)C=C3)C(C)=C(Cl)C=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(4-butoxyphenyl)-7-chloro-8-methyl-
- 2-(4-Butoxyphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride
- 2-(4-butoxyphenyl)-7-chloro-8-methylquinoline-4-carbonyl chloride
- 4-quinolinecarbonyl chloride, 2-(4-butoxyphenyl)-7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.