CAS 1160255-90-2
:8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The presence of the carbonyl chloride group suggests that it can participate in nucleophilic acyl substitution reactions, making it a potential intermediate in organic synthesis. The 2-methylpropoxy group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable chemical databases for comprehensive characterization.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-12(2)11-25-14-8-6-13(7-9-14)18-10-16(20(22)24)15-4-3-5-17(21)19(15)23-18/h3-10,12H,11H2,1-2H3
InChI key:InChIKey=ZYJACRAKWGBVOA-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C(Cl)=CC=C2
Synonyms:- 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 8-chloro-2-[4-(2-methylpropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.