CAS 1160255-90-2: 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description: 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The presence of the carbonyl chloride group suggests that it can participate in nucleophilic acyl substitution reactions, making it a potential intermediate in organic synthesis. The 2-methylpropoxy group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable chemical databases for comprehensive characterization.

Formula: C₂₀H₁₇Cl₂NO₂

InChI: InChI=1S/C20H17Cl2NO2/c1-12(2)11-25-14-8-6-13(7-9-14)18-10-16(20(22)24)15-4-3-5-17(21)19(15)23-18/h3-10,12H,11H2,1-2H3

InChI key: InChIKey=ZYJACRAKWGBVOA-UHFFFAOYSA-N

SMILES: O=C(Cl)C=1C=C(N=C2C(Cl)=CC=CC21)C=3C=CC(OCC(C)C)=CC3

Synonyms:

• 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-[4-(2-methylpropoxy)phenyl]-

8-chloro-2-(4-isobutoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160255-90-2

• Molecular weight: 374.260009765625

8-Chloro-2-(4-isobutoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160255-90-2

Please enquire for more information about 8-Chloro-2-(4-isobutoxyphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₂₀H₁₇Cl₂NO₂
• Purity: Min. 95%
• Molecular weight: 374.26 g/mol