CAS 1160255-92-4

7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring contributes to its chemical reactivity and potential biological activity. The compound also features a phenyl group substituted with a 2-methylpropoxy moiety, which may influence its solubility and interaction with biological targets. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in various synthetic applications. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a lead compound for drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety precautions should be taken when handling this compound due to its reactive nature.

Formula: C₂₁H₁₉Cl₂NO₂

InChI: InChI=1S/C21H19Cl2NO2/c1-12(2)11-26-15-6-4-14(5-7-15)19-10-17(21(23)25)16-8-9-18(22)13(3)20(16)24-19/h4-10,12H,11H2,1-3H3

InChI key: InChIKey=BFLXAMOKJJGBIK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-