CAS 1160255-94-6

2-(3-Butoxyphenyl)-8-chloro-4-quinolinecarbonyl chloride

Description:

2-(3-Butoxyphenyl)-8-chloro-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The presence of the butoxyphenyl group may enhance its stability and reactivity, making it a potential candidate for various chemical reactions, including acylation and nucleophilic substitution. The carbonyl chloride functional group suggests that it can act as an acylating agent, which is useful in organic synthesis. Additionally, the chloro substituent may impart biological activity, making this compound of interest in medicinal chemistry. Overall, its unique structural features and functional groups contribute to its potential applications in pharmaceuticals and agrochemicals, although specific biological or chemical properties would require further investigation through empirical studies.

Formula: C₂₀H₁₇Cl₂NO₂

InChI: InChI=1S/C20H17Cl2NO2/c1-2-3-10-25-14-7-4-6-13(11-14)18-12-16(20(22)24)15-8-5-9-17(21)19(15)23-18/h4-9,11-12H,2-3,10H2,1H3

InChI key: InChIKey=VNKUSUWBSHWQCW-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCCC)=CC=C3)C(Cl)=CC=C2

Synonyms:

• 2-(3-Butoxyphenyl)-8-chloro-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-butoxyphenyl)-8-chloro-