CAS 1160255-98-0: 8-Chloro-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
Description:8-Chloro-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The presence of the carbonyl chloride group suggests that it can participate in nucleophilic acyl substitution reactions, making it a potential intermediate in organic synthesis. The 2-methylpropoxy group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, which could be explored in pharmaceutical applications. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-12(2)11-25-14-6-3-5-13(9-14)18-10-16(20(22)24)15-7-4-8-17(21)19(15)23-18/h3-10,12H,11H2,1-2H3
InChI key:InChIKey=ANWMICDELYKXAH-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=C(N=C2C(Cl)=CC=CC21)C=3C=CC=C(OCC(C)C)C3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 8-chloro-2-(3-isobutoxyphenyl)quinoline-4-carbonyl chloride REF: 10-F368579CAS: 1160255-98-0 | - - - | - - - | Discontinued product |
![]() | 8-Chloro-2-(3-isobutoxyphenyl)quinoline-4-carbonyl chloride REF: 3D-FC120902CAS: 1160255-98-0 | Min. 95% | - - - | Discontinued product |

8-chloro-2-(3-isobutoxyphenyl)quinoline-4-carbonyl chloride
Ref: 10-F368579
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

8-Chloro-2-(3-isobutoxyphenyl)quinoline-4-carbonyl chloride
Ref: 3D-FC120902
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |