CAS 1160256-00-7

7-Chloro-8-methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

7-Chloro-8-methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring contributes to its chemical reactivity and potential biological activity. The compound also features a phenyl group with a propoxy substituent, which enhances its lipophilicity and may influence its pharmacokinetic properties. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in various synthetic applications. This compound may exhibit interesting biological properties, potentially serving as a lead compound in drug discovery. However, specific data regarding its solubility, stability, and biological activity would require further investigation through experimental studies. Safety precautions should be observed when handling this compound due to its reactive nature and potential toxicity.

Formula: C₂₁H₁₉Cl₂NO₂

InChI: InChI=1S/C21H19Cl2NO2/c1-12(2)11-26-15-6-4-5-14(9-15)19-10-17(21(23)25)16-7-8-18(22)13(3)20(16)24-19/h4-10,12H,11H2,1-3H3

InChI key: InChIKey=SOGDIYYKGXGILL-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC(C)C)=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-8-methyl-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-[3-(2-methylpropoxy)phenyl]-