CAS 1160256-02-9

8-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a chloro group at the 8-position and an ethylphenyl substituent at the 2-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various chemical reactions, including the formation of amides and esters. This compound may exhibit biological activity due to its structural features, which could be explored for pharmaceutical applications. Its molecular properties, such as solubility and stability, would depend on the specific conditions of use, including solvent choice and temperature. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be taken when working with this substance in a laboratory setting.

Formula: C₁₈H₁₃Cl₂NO

InChI: InChI=1S/C18H13Cl2NO/c1-2-11-6-8-12(9-7-11)16-10-14(18(20)22)13-4-3-5-15(19)17(13)21-16/h3-10H,2H2,1H3

InChI key: InChIKey=BTOYDGMAHHTDPK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC)C=C3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-chloro-2-(4-ethylphenyl)-
• 8-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride