CymitQuimica logo

CAS 1160256-08-5

:

7-Chloro-8-methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride

Description:
7-Chloro-8-methyl-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a chloro substituent at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique reactivity and potential biological activity. The presence of a propylphenyl group at the 2-position enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The carbonyl chloride functional group indicates that it can undergo nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. This compound may exhibit various pharmacological properties, potentially making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. As with many synthetic compounds, handling should be done with care, considering safety protocols due to the presence of reactive functional groups.
Formula:C20H17Cl2NO
InChI:InChI=1S/C20H17Cl2NO/c1-3-4-13-5-7-14(8-6-13)18-11-16(20(22)24)15-9-10-17(21)12(2)19(15)23-18/h5-11H,3-4H2,1-2H3
InChI key:InChIKey=MIZLKSVQPUOMHM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCC)C=C3)C(C)=C(Cl)C=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.