CymitQuimica logo

CAS 1160256-12-1

:

7-Chloro-8-methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride

Description:
7-Chloro-8-methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring contributes to its reactivity and potential biological activity. The compound also features a carbonyl chloride functional group, which is known for its reactivity, particularly in acylation reactions. The 4-(1-methylethyl)phenyl substituent enhances the lipophilicity of the molecule, potentially influencing its pharmacokinetic properties. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that can interact with biological targets. However, specific biological activities, solubility, stability, and toxicity would require further investigation through experimental studies. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical applications, particularly in drug design and synthesis.
Formula:C20H17Cl2NO
InChI:InChI=1S/C20H17Cl2NO/c1-11(2)13-4-6-14(7-5-13)18-10-16(20(22)24)15-8-9-17(21)12(3)19(15)23-18/h4-11H,1-3H3
InChI key:InChIKey=QMVBCKUQAHDNPI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)C)C=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-[4-(1-methylethyl)phenyl]-
  • 7-Chloro-8-methyl-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.