CymitQuimica logo

CAS 1160256-15-4

:

8-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-4-quinolinecarbonyl chloride

Description:
8-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The bulky tert-butyl group attached to the phenyl ring contributes to its steric hindrance, potentially influencing its interactions in biological systems or chemical reactions. The carbonyl chloride functional group suggests that it may participate in acylation reactions or serve as a reactive intermediate in synthetic pathways. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could show biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and potential applications would be influenced by the presence of these functional groups, making it a compound of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C20H17Cl2NO
InChI:InChI=1S/C20H17Cl2NO/c1-20(2,3)13-9-7-12(8-10-13)17-11-15(19(22)24)14-5-4-6-16(21)18(14)23-17/h4-11H,1-3H3
InChI key:InChIKey=XTSLRNBWMWTHFW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)(C)C)C=C3)C(Cl)=CC=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 8-chloro-2-[4-(1,1-dimethylethyl)phenyl]-
  • 8-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.