CAS 1160256-17-6: 7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride
Description:7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a carbonyl chloride moiety indicates potential reactivity, particularly in nucleophilic substitution reactions. The bulky tert-butyl group at the para position of the phenyl ring contributes to steric hindrance, which can influence the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests it could interact with biological targets, potentially leading to various pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a unique combination of structural features that may lend itself to diverse applications in medicinal chemistry and related fields.
Formula:C21H19Cl2NO
InChI:InChI=1S/C21H19Cl2NO/c1-12-17(22)10-9-15-16(20(23)25)11-18(24-19(12)15)13-5-7-14(8-6-13)21(2,3)4/h5-11H,1-4H3
InChI key:InChIKey=OEKKTIRITXKVKN-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=C(N=C2C1C=CC(Cl)=C2C)C=3C=CC(=CC3)C(C)(C)C
- Synonyms:
- 7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 7-chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(4-tert-butylphenyl)-7-chloro-8-methylquinoline-4-carbonyl chloride REF: 10-F368588CAS: 1160256-17-6 | - - - | - - - | Discontinued product |
![]() | 2-(4-tert-Butylphenyl)-7-chloro-8-methylquinoline-4-carbonyl chloride REF: 3D-FB120911CAS: 1160256-17-6 | Min. 95% | - - - | Discontinued product |

2-(4-tert-butylphenyl)-7-chloro-8-methylquinoline-4-carbonyl chloride
Ref: 10-F368588
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

2-(4-tert-Butylphenyl)-7-chloro-8-methylquinoline-4-carbonyl chloride
Ref: 3D-FB120911
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |