CAS 1160256-30-3

2-(4-Butylphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride

Description:

2-(4-Butylphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160256-30-3, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing nitrogen. This substance features a butyl group and a chloro substituent, contributing to its unique chemical properties. The presence of the carbonyl chloride functional group indicates that it can participate in acylation reactions, making it a potential intermediate in organic synthesis. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which may influence its solubility in organic solvents. Additionally, the chlorine atom may impart specific reactivity patterns, such as electrophilic substitution. Its structural complexity suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities or toxicity profiles would require further investigation. Overall, this compound exemplifies the diverse chemistry associated with substituted quinolines, which are of significant interest in various fields of research.

Formula: C₂₁H₁₉Cl₂NO

InChI: InChI=1S/C21H19Cl2NO/c1-3-4-5-14-6-8-15(9-7-14)19-12-17(21(23)25)16-10-11-18(22)13(2)20(16)24-19/h6-12H,3-5H2,1-2H3

InChI key: InChIKey=XMODLJONGCHBBG-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCCC)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(4-butylphenyl)-7-chloro-8-methyl-
• 2-(4-Butylphenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride